C23H34O — CID 156727307
1-methoxy-3-methyl-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylbenzene (PubChem CID 156727307) has the molecular formula C23H34O and a molecular weight of 326.52 g/mol. Its IUPAC name is 1-methoxy-3-methyl-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylbenzene.
| Compound Name | 1-methoxy-3-methyl-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylbenzene |
|---|---|
| PubChem CID | 156727307 |
| Molecular Formula | C23H34O |
| Molecular Weight | 326.52 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | 1-methoxy-3-methyl-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylbenzene |
| SMILES | C=C(C)C1CCC(C)=CC1c1c(C)cc(CCCCC)cc1OC |
| InChI | InChI=1S/C23H34O/c1-7-8-9-10-19-14-18(5)23(22(15-19)24-6)21-13-17(4)11-12-20(21)16(2)3/h13-15,20-21H,2,7-12H2,1,3-6H3 |
| InChIKey | QUFPQUWLNHVDQH-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.52 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|