C29H46O6 — CID 155570351
1,3-bis(2-methoxyethoxymethoxy)-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylbenzene (PubChem CID 155570351) has the molecular formula C29H46O6 and a molecular weight of 490.68 g/mol. Its IUPAC name is 1,3-bis(2-methoxyethoxymethoxy)-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylbenzene.
| Compound Name | 1,3-bis(2-methoxyethoxymethoxy)-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylbenzene |
|---|---|
| PubChem CID | 155570351 |
| Molecular Formula | C29H46O6 |
| Molecular Weight | 490.68 g/mol |
| Exact Mass | 490.33 |
| IUPAC Name | 1,3-bis(2-methoxyethoxymethoxy)-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylbenzene |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(OCOCCOC)cc(CCCCC)cc1OCOCCOC |
| InChI | InChI=1S/C29H46O6/c1-7-8-9-10-24-18-27(34-20-32-15-13-30-5)29(28(19-24)35-21-33-16-14-31-6)26-17-23(4)11-12-25(26)22(2)3/h17-19,25-26H,2,7-16,20-21H2,1,3-6H3/t25-,26+/m0/s1 |
| InChIKey | LGTUJPKSJFLKQR-IZZNHLLZSA-N |
| XLogP | 6.43 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.68 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|