C24H35NO4 — CID 69189934
2-[3-hydroxy-2-[(6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]ethylcarbamic acid (PubChem CID 69189934) has the molecular formula C24H35NO4 and a molecular weight of 401.55 g/mol. Its IUPAC name is 2-[3-hydroxy-2-[(6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]ethylcarbamic acid.
| Compound Name | 2-[3-hydroxy-2-[(6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]ethylcarbamic acid |
|---|---|
| PubChem CID | 69189934 |
| Molecular Formula | C24H35NO4 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.26 |
| IUPAC Name | 2-[3-hydroxy-2-[(6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]ethylcarbamic acid |
| SMILES | C=C(C)[C@@H]1CCC(C)=CC1c1c(O)cc(CCCCC)cc1OCCNC(=O)O |
| InChI | InChI=1S/C24H35NO4/c1-5-6-7-8-18-14-21(26)23(22(15-18)29-12-11-25-24(27)28)20-13-17(4)9-10-19(20)16(2)3/h13-15,19-20,25-26H,2,5-12H2,1,3-4H3,(H,27,28)/t19-,20?/m0/s1 |
| InChIKey | WVBFNWDLNJMRID-XJDOXCRVSA-N |
| XLogP | 5.79 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|