C21H29NaO5S — CID 175947452
sodium [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] sulfate (PubChem CID 175947452) has the molecular formula C21H29NaO5S and a molecular weight of 416.52 g/mol. Its IUPAC name is sodium [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] sulfate.
| Compound Name | sodium [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] sulfate |
|---|---|
| PubChem CID | 175947452 |
| Molecular Formula | C21H29NaO5S |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | sodium [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] sulfate |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(CCCCC)cc1OS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C21H30O5S.Na/c1-5-6-7-8-16-12-19(22)21(20(13-16)26-27(23,24)25)18-11-15(4)9-10-17(18)14(2)3;/h11-13,17-18,22H,2,5-10H2,1,3-4H3,(H,23,24,25);/q;+1/p-1/t17-,18+;/m0./s1 |
| InChIKey | OEGRZCBVNZEDPZ-CJRXIRLBSA-M |
| XLogP | 1.98 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|