C29H34O7 — CID 172870163
1-O-(3,5-dihydroxyphenyl) 2-O-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] oxalate (PubChem CID 172870163) has the molecular formula C29H34O7 and a molecular weight of 494.58 g/mol. Its IUPAC name is 1-O-(3,5-dihydroxyphenyl) 2-O-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] oxalate.
| Compound Name | 1-O-(3,5-dihydroxyphenyl) 2-O-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] oxalate |
|---|---|
| PubChem CID | 172870163 |
| Molecular Formula | C29H34O7 |
| Molecular Weight | 494.58 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | 1-O-(3,5-dihydroxyphenyl) 2-O-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] oxalate |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(CCCCC)cc1OC(=O)C(=O)Oc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C29H34O7/c1-5-6-7-8-19-12-25(32)27(24-11-18(4)9-10-23(24)17(2)3)26(13-19)36-29(34)28(33)35-22-15-20(30)14-21(31)16-22/h11-16,23-24,30-32H,2,5-10H2,1,3-4H3/t23-,24+/m0/s1 |
| InChIKey | MGCHJVIXMJQHBR-BJKOFHAPSA-N |
| XLogP | 6.06 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.58 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|