C24H34O4 — CID 75603237
[3-hydroxy-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenyl] 2-hydroxypropanoate (PubChem CID 75603237) has the molecular formula C24H34O4 and a molecular weight of 386.53 g/mol. Its IUPAC name is [3-hydroxy-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenyl] 2-hydroxypropanoate.
| Compound Name | [3-hydroxy-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenyl] 2-hydroxypropanoate |
|---|---|
| PubChem CID | 75603237 |
| Molecular Formula | C24H34O4 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | [3-hydroxy-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenyl] 2-hydroxypropanoate |
| SMILES | C=C(C)C1CCC(C)=CC1c1c(O)cc(CCCCC)cc1OC(=O)C(C)O |
| InChI | InChI=1S/C24H34O4/c1-6-7-8-9-18-13-21(26)23(22(14-18)28-24(27)17(5)25)20-12-16(4)10-11-19(20)15(2)3/h12-14,17,19-20,25-26H,2,6-11H2,1,3-5H3 |
| InChIKey | XTKOGKVLVBOBTF-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|