C28H44NO7P — CID 177092779
[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 2-(ethylamino)-2-[hydroxy(propan-2-yloxy)phosphoryl]oxyacetate (PubChem CID 177092779) has the molecular formula C28H44NO7P and a molecular weight of 537.63 g/mol. Its IUPAC name is [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 2-(ethylamino)-2-[hydroxy(propan-2-yloxy)phosphoryl]oxyacetate.
| Compound Name | [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 2-(ethylamino)-2-[hydroxy(propan-2-yloxy)phosphoryl]oxyacetate |
|---|---|
| PubChem CID | 177092779 |
| Molecular Formula | C28H44NO7P |
| Molecular Weight | 537.63 g/mol |
| Exact Mass | 537.29 |
| IUPAC Name | [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 2-(ethylamino)-2-[hydroxy(propan-2-yloxy)phosphoryl]oxyacetate |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(CCCCC)cc1OC(=O)C(NCC)OP(=O)(O)OC(C)C |
| InChI | InChI=1S/C28H44NO7P/c1-8-10-11-12-21-16-24(30)26(23-15-20(7)13-14-22(23)18(3)4)25(17-21)34-28(31)27(29-9-2)36-37(32,33)35-19(5)6/h15-17,19,22-23,27,29-30H,3,8-14H2,1-2,4-7H3,(H,32,33)/t22-,23+,27?/m0/s1 |
| InChIKey | NYMZJLSQNOCAQD-FOCHENRBSA-N |
| XLogP | 6.52 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.63 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|