C30H40NO7P — CID 177092772
[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-propylphenyl] 2-(ethylamino)-2-[hydroxy(phenylmethoxy)phosphoryl]oxyacetate (PubChem CID 177092772) has the molecular formula C30H40NO7P and a molecular weight of 557.62 g/mol. Its IUPAC name is [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-propylphenyl] 2-(ethylamino)-2-[hydroxy(phenylmethoxy)phosphoryl]oxyacetate.
| Compound Name | [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-propylphenyl] 2-(ethylamino)-2-[hydroxy(phenylmethoxy)phosphoryl]oxyacetate |
|---|---|
| PubChem CID | 177092772 |
| Molecular Formula | C30H40NO7P |
| Molecular Weight | 557.62 g/mol |
| Exact Mass | 557.25 |
| IUPAC Name | [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-propylphenyl] 2-(ethylamino)-2-[hydroxy(phenylmethoxy)phosphoryl]oxyacetate |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(CCC)cc1OC(=O)C(NCC)OP(=O)(O)OCc1ccccc1 |
| InChI | InChI=1S/C30H40NO7P/c1-6-11-23-17-26(32)28(25-16-21(5)14-15-24(25)20(3)4)27(18-23)37-30(33)29(31-7-2)38-39(34,35)36-19-22-12-9-8-10-13-22/h8-10,12-13,16-18,24-25,29,31-32H,3,6-7,11,14-15,19H2,1-2,4-5H3,(H,34,35)/t24-,25+,29?/m0/s1 |
| InChIKey | HLYFJMXUUWKSPH-FEFWDCFMSA-N |
| XLogP | 6.54 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.62 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|