C25H43N2O7P — CID 175835061
azane;[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 4-phosphonooxybutanoate (PubChem CID 175835061) has the molecular formula C25H43N2O7P and a molecular weight of 514.60 g/mol. Its IUPAC name is azane;[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 4-phosphonooxybutanoate.
| Compound Name | azane;[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 4-phosphonooxybutanoate |
|---|---|
| PubChem CID | 175835061 |
| Molecular Formula | C25H43N2O7P |
| Molecular Weight | 514.60 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | azane;[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 4-phosphonooxybutanoate |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(CCCCC)cc1OC(=O)CCCOP(=O)(O)O.N.N |
| InChI | InChI=1S/C25H37O7P.2H3N/c1-5-6-7-9-19-15-22(26)25(21-14-18(4)11-12-20(21)17(2)3)23(16-19)32-24(27)10-8-13-31-33(28,29)30;;/h14-16,20-21,26H,2,5-13H2,1,3-4H3,(H2,28,29,30);2*1H3/t20-,21+;;/m0../s1 |
| InChIKey | LEHWFMQGSSFHTK-DDZPGPNZSA-N |
| XLogP | 6.26 |
| TPSA | 183.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.60 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|