C27H37NO8 — CID 118620213
4-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-(7-nitrooxyheptyl)phenoxy]-4-oxobutanoic acid (PubChem CID 118620213) has the molecular formula C27H37NO8 and a molecular weight of 503.59 g/mol. Its IUPAC name is 4-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-(7-nitrooxyheptyl)phenoxy]-4-oxobutanoic acid.
| Compound Name | 4-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-(7-nitrooxyheptyl)phenoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 118620213 |
| Molecular Formula | C27H37NO8 |
| Molecular Weight | 503.59 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | 4-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-(7-nitrooxyheptyl)phenoxy]-4-oxobutanoic acid |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(CCCCCCCO[N+](=O)[O-])cc1OC(=O)CCC(=O)O |
| InChI | InChI=1S/C27H37NO8/c1-18(2)21-11-10-19(3)15-22(21)27-23(29)16-20(9-7-5-4-6-8-14-35-28(33)34)17-24(27)36-26(32)13-12-25(30)31/h15-17,21-22,29H,1,4-14H2,2-3H3,(H,30,31)/t21-,22+/m0/s1 |
| InChIKey | APGWIQZYNZSOSC-FCHUYYIVSA-N |
| XLogP | 5.88 |
| TPSA | 136.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.59 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|