C23H31O8P-2 — CID 177092582
[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]carbonyloxymethyl phosphate (PubChem CID 177092582) has the molecular formula C23H31O8P-2 and a molecular weight of 466.47 g/mol. Its IUPAC name is [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]carbonyloxymethyl phosphate.
| Compound Name | [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]carbonyloxymethyl phosphate |
|---|---|
| PubChem CID | 177092582 |
| Molecular Formula | C23H31O8P-2 |
| Molecular Weight | 466.47 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]carbonyloxymethyl phosphate |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(CCCCC)cc1OC(=O)OCOP(=O)([O-])[O-] |
| InChI | InChI=1S/C23H33O8P/c1-5-6-7-8-17-12-20(24)22(19-11-16(4)9-10-18(19)15(2)3)21(13-17)31-23(25)29-14-30-32(26,27)28/h11-13,18-19,24H,2,5-10,14H2,1,3-4H3,(H2,26,27,28)/p-2/t18-,19+/m0/s1 |
| InChIKey | QPKHGIFVHZDZHG-RBUKOAKNSA-L |
| XLogP | 4.46 |
| TPSA | 128.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.47 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|