C33H50O7P- — CID 177092504
heptyl [1-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]carbonylcyclobutyl] phosphate (PubChem CID 177092504) has the molecular formula C33H50O7P- and a molecular weight of 589.73 g/mol. Its IUPAC name is heptyl [1-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]carbonylcyclobutyl] phosphate.
| Compound Name | heptyl [1-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]carbonylcyclobutyl] phosphate |
|---|---|
| PubChem CID | 177092504 |
| Molecular Formula | C33H50O7P- |
| Molecular Weight | 589.73 g/mol |
| Exact Mass | 589.33 |
| IUPAC Name | heptyl [1-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]carbonylcyclobutyl] phosphate |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(CCCCC)cc1OC(=O)C1(OP(=O)([O-])OCCCCCCC)CCC1 |
| InChI | InChI=1S/C33H51O7P/c1-6-8-10-11-13-20-38-41(36,37)40-33(18-14-19-33)32(35)39-30-23-26(15-12-9-7-2)22-29(34)31(30)28-21-25(5)16-17-27(28)24(3)4/h21-23,27-28,34H,3,6-20H2,1-2,4-5H3,(H,36,37)/p-1/t27-,28+/m0/s1 |
| InChIKey | IZZCUQJYPXWOLF-WUFINQPMSA-M |
| XLogP | 8.44 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.73 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|