C37H59O7P — CID 177092669
[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 1-[decoxy(hydroxy)phosphoryl]oxycyclopentane-1-carboxylate (PubChem CID 177092669) has the molecular formula C37H59O7P and a molecular weight of 646.85 g/mol. Its IUPAC name is [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 1-[decoxy(hydroxy)phosphoryl]oxycyclopentane-1-carboxylate.
| Compound Name | [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 1-[decoxy(hydroxy)phosphoryl]oxycyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 177092669 |
| Molecular Formula | C37H59O7P |
| Molecular Weight | 646.85 g/mol |
| Exact Mass | 646.40 |
| IUPAC Name | [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 1-[decoxy(hydroxy)phosphoryl]oxycyclopentane-1-carboxylate |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(CCCCC)cc1OC(=O)C1(OP(=O)(O)OCCCCCCCCCC)CCCC1 |
| InChI | InChI=1S/C37H59O7P/c1-6-8-10-11-12-13-14-18-24-42-45(40,41)44-37(22-16-17-23-37)36(39)43-34-27-30(19-15-9-7-2)26-33(38)35(34)32-25-29(5)20-21-31(32)28(3)4/h25-27,31-32,38H,3,6-24H2,1-2,4-5H3,(H,40,41)/t31-,32+/m0/s1 |
| InChIKey | GJNAJRPSYDJPMA-AJQTZOPKSA-N |
| XLogP | 10.63 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.85 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|