C35H54O7P- — CID 177092712
[1-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]carbonylcyclopentyl] 2-propylpentyl phosphate (PubChem CID 177092712) has the molecular formula C35H54O7P- and a molecular weight of 617.78 g/mol. Its IUPAC name is [1-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]carbonylcyclopentyl] 2-propylpentyl phosphate.
| Compound Name | [1-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]carbonylcyclopentyl] 2-propylpentyl phosphate |
|---|---|
| PubChem CID | 177092712 |
| Molecular Formula | C35H54O7P- |
| Molecular Weight | 617.78 g/mol |
| Exact Mass | 617.36 |
| IUPAC Name | [1-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]carbonylcyclopentyl] 2-propylpentyl phosphate |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(CCCCC)cc1OC(=O)C1(OP(=O)([O-])OCC(CCC)CCC)CCCC1 |
| InChI | InChI=1S/C35H55O7P/c1-7-10-11-16-28-22-31(36)33(30-21-26(6)17-18-29(30)25(4)5)32(23-28)41-34(37)35(19-12-13-20-35)42-43(38,39)40-24-27(14-8-2)15-9-3/h21-23,27,29-30,36H,4,7-20,24H2,1-3,5-6H3,(H,38,39)/p-1/t29-,30+/m0/s1 |
| InChIKey | MQAOUTUXJNYORD-XZWHSSHBSA-M |
| XLogP | 9.08 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.78 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|