C32H48O7P- — CID 177092890
[1-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]carbonylcyclopentyl] pentyl phosphate (PubChem CID 177092890) has the molecular formula C32H48O7P- and a molecular weight of 575.70 g/mol. Its IUPAC name is [1-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]carbonylcyclopentyl] pentyl phosphate.
| Compound Name | [1-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]carbonylcyclopentyl] pentyl phosphate |
|---|---|
| PubChem CID | 177092890 |
| Molecular Formula | C32H48O7P- |
| Molecular Weight | 575.70 g/mol |
| Exact Mass | 575.31 |
| IUPAC Name | [1-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenoxy]carbonylcyclopentyl] pentyl phosphate |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(CCCCC)cc1OC(=O)C1(OP(=O)([O-])OCCCCC)CCCC1 |
| InChI | InChI=1S/C32H49O7P/c1-6-8-10-14-25-21-28(33)30(27-20-24(5)15-16-26(27)23(3)4)29(22-25)38-31(34)32(17-11-12-18-32)39-40(35,36)37-19-13-9-7-2/h20-22,26-27,33H,3,6-19H2,1-2,4-5H3,(H,35,36)/p-1/t26-,27+/m0/s1 |
| InChIKey | REHXERLXQXRZMY-RRPNLBNLSA-M |
| XLogP | 8.05 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.70 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|