C27H38O8P- — CID 177092640
[1-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-propylphenoxy]carbonylcyclobutyl] 2-methoxyethyl phosphate (PubChem CID 177092640) has the molecular formula C27H38O8P- and a molecular weight of 521.57 g/mol. Its IUPAC name is [1-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-propylphenoxy]carbonylcyclobutyl] 2-methoxyethyl phosphate.
| Compound Name | [1-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-propylphenoxy]carbonylcyclobutyl] 2-methoxyethyl phosphate |
|---|---|
| PubChem CID | 177092640 |
| Molecular Formula | C27H38O8P- |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | [1-[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-propylphenoxy]carbonylcyclobutyl] 2-methoxyethyl phosphate |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(CCC)cc1OC(=O)C1(OP(=O)([O-])OCCOC)CCC1 |
| InChI | InChI=1S/C27H39O8P/c1-6-8-20-16-23(28)25(22-15-19(4)9-10-21(22)18(2)3)24(17-20)34-26(29)27(11-7-12-27)35-36(30,31)33-14-13-32-5/h15-17,21-22,28H,2,6-14H2,1,3-5H3,(H,30,31)/p-1/t21-,22+/m0/s1 |
| InChIKey | FJSBBSICFAPMMP-FCHUYYIVSA-M |
| XLogP | 5.34 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|