C31H47O7P — CID 177092692
[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 1-[hydroxy(propan-2-yloxy)phosphoryl]oxycyclohexane-1-carboxylate (PubChem CID 177092692) has the molecular formula C31H47O7P and a molecular weight of 562.68 g/mol. Its IUPAC name is [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 1-[hydroxy(propan-2-yloxy)phosphoryl]oxycyclohexane-1-carboxylate.
| Compound Name | [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 1-[hydroxy(propan-2-yloxy)phosphoryl]oxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 177092692 |
| Molecular Formula | C31H47O7P |
| Molecular Weight | 562.68 g/mol |
| Exact Mass | 562.31 |
| IUPAC Name | [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 1-[hydroxy(propan-2-yloxy)phosphoryl]oxycyclohexane-1-carboxylate |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(CCCCC)cc1OC(=O)C1(OP(=O)(O)OC(C)C)CCCCC1 |
| InChI | InChI=1S/C31H47O7P/c1-7-8-10-13-24-19-27(32)29(26-18-23(6)14-15-25(26)21(2)3)28(20-24)36-30(33)31(16-11-9-12-17-31)38-39(34,35)37-22(4)5/h18-20,22,25-26,32H,2,7-17H2,1,3-6H3,(H,34,35)/t25-,26+/m0/s1 |
| InChIKey | IEYUYMUTXVIMQO-IZZNHLLZSA-N |
| XLogP | 8.29 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.68 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|