C32H41O7P — CID 177092893
[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-propylphenyl] 1-[hydroxy(phenoxy)phosphoryl]oxycyclohexane-1-carboxylate (PubChem CID 177092893) has the molecular formula C32H41O7P and a molecular weight of 568.65 g/mol. Its IUPAC name is [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-propylphenyl] 1-[hydroxy(phenoxy)phosphoryl]oxycyclohexane-1-carboxylate.
| Compound Name | [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-propylphenyl] 1-[hydroxy(phenoxy)phosphoryl]oxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 177092893 |
| Molecular Formula | C32H41O7P |
| Molecular Weight | 568.65 g/mol |
| Exact Mass | 568.26 |
| IUPAC Name | [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-propylphenyl] 1-[hydroxy(phenoxy)phosphoryl]oxycyclohexane-1-carboxylate |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(CCC)cc1OC(=O)C1(OP(=O)(O)Oc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C32H41O7P/c1-5-12-24-20-28(33)30(27-19-23(4)15-16-26(27)22(2)3)29(21-24)37-31(34)32(17-10-7-11-18-32)39-40(35,36)38-25-13-8-6-9-14-25/h6,8-9,13-14,19-21,26-27,33H,2,5,7,10-12,15-18H2,1,3-4H3,(H,35,36)/t26-,27+/m0/s1 |
| InChIKey | JZMQXRJBRIFAGA-RRPNLBNLSA-N |
| XLogP | 8.16 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.65 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|