C32H44NO7P — CID 175835086
azane;[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 1-[hydroxy(phenylmethoxy)phosphoryl]oxycyclopropane-1-carboxylate (PubChem CID 175835086) has the molecular formula C32H44NO7P and a molecular weight of 585.68 g/mol. Its IUPAC name is azane;[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 1-[hydroxy(phenylmethoxy)phosphoryl]oxycyclopropane-1-carboxylate.
| Compound Name | azane;[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 1-[hydroxy(phenylmethoxy)phosphoryl]oxycyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 175835086 |
| Molecular Formula | C32H44NO7P |
| Molecular Weight | 585.68 g/mol |
| Exact Mass | 585.29 |
| IUPAC Name | azane;[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 1-[hydroxy(phenylmethoxy)phosphoryl]oxycyclopropane-1-carboxylate |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(CCCCC)cc1OC(=O)C1(OP(=O)(O)OCc2ccccc2)CC1.N |
| InChI | InChI=1S/C32H41O7P.H3N/c1-5-6-8-13-25-19-28(33)30(27-18-23(4)14-15-26(27)22(2)3)29(20-25)38-31(34)32(16-17-32)39-40(35,36)37-21-24-11-9-7-10-12-24;/h7,9-12,18-20,26-27,33H,2,5-6,8,13-17,21H2,1,3-4H3,(H,35,36);1H3/t26-,27+;/m0./s1 |
| InChIKey | WPJLDDYPLTVKLP-MFHXMFJOSA-N |
| XLogP | 8.07 |
| TPSA | 137.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.68 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|