C31H41O8P — CID 177092637
[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 1-[hydroxy(phenylmethoxy)phosphoryl]oxyethyl carbonate (PubChem CID 177092637) has the molecular formula C31H41O8P and a molecular weight of 572.64 g/mol. Its IUPAC name is [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 1-[hydroxy(phenylmethoxy)phosphoryl]oxyethyl carbonate.
| Compound Name | [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 1-[hydroxy(phenylmethoxy)phosphoryl]oxyethyl carbonate |
|---|---|
| PubChem CID | 177092637 |
| Molecular Formula | C31H41O8P |
| Molecular Weight | 572.64 g/mol |
| Exact Mass | 572.25 |
| IUPAC Name | [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] 1-[hydroxy(phenylmethoxy)phosphoryl]oxyethyl carbonate |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(CCCCC)cc1OC(=O)OC(C)OP(=O)(O)OCc1ccccc1 |
| InChI | InChI=1S/C31H41O8P/c1-6-7-9-14-25-18-28(32)30(27-17-22(4)15-16-26(27)21(2)3)29(19-25)38-31(33)37-23(5)39-40(34,35)36-20-24-12-10-8-11-13-24/h8,10-13,17-19,23,26-27,32H,2,6-7,9,14-16,20H2,1,3-5H3,(H,34,35)/t23?,26-,27+/m0/s1 |
| InChIKey | ZVABXTFQVKBCQA-AUHZSHLXSA-N |
| XLogP | 8.34 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.64 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|