C32H41NO4 — CID 155447767
(1-benzylaziridin-2-yl)methyl [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] carbonate (PubChem CID 155447767) has the molecular formula C32H41NO4 and a molecular weight of 503.68 g/mol. Its IUPAC name is (1-benzylaziridin-2-yl)methyl [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] carbonate.
| Compound Name | (1-benzylaziridin-2-yl)methyl [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] carbonate |
|---|---|
| PubChem CID | 155447767 |
| Molecular Formula | C32H41NO4 |
| Molecular Weight | 503.68 g/mol |
| Exact Mass | 503.30 |
| IUPAC Name | (1-benzylaziridin-2-yl)methyl [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] carbonate |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(CCCCC)cc1OC(=O)OCC1CN1Cc1ccccc1 |
| InChI | InChI=1S/C32H41NO4/c1-5-6-8-13-25-17-29(34)31(28-16-23(4)14-15-27(28)22(2)3)30(18-25)37-32(35)36-21-26-20-33(26)19-24-11-9-7-10-12-24/h7,9-12,16-18,26-28,34H,2,5-6,8,13-15,19-21H2,1,3-4H3/t26?,27-,28+,33?/m0/s1 |
| InChIKey | BFTVBOPOCYAMQF-ILOQJTFPSA-N |
| XLogP | 7.54 |
| TPSA | 58.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.68 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|