C31H49BN2O5 — CID 167675382
CID 167675382 (PubChem CID 167675382) has the molecular formula C31H49BN2O5 and a molecular weight of 541.56 g/mol.
| Compound Name | CID 167675382 |
|---|---|
| PubChem CID | 167675382 |
| Molecular Formula | C31H49BN2O5 |
| Molecular Weight | 541.56 g/mol |
| Exact Mass | 541.38 |
| IUPAC Name | — |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(CCCCC)cc1OC(=O)OCC1CN1C.CN1CC1CO.[2H]C[B] |
| InChI | InChI=1S/C26H37NO4.C4H9NO.CH3B/c1-6-7-8-9-19-13-23(28)25(22-12-18(4)10-11-21(22)17(2)3)24(14-19)31-26(29)30-16-20-15-27(20)5;1-5-2-4(5)3-6;1-2/h12-14,20-22,28H,2,6-11,15-16H2,1,3-5H3;4,6H,2-3H2,1H3;1H3/t20?,21-,22+,27?;;/m0../s1/i;;1D |
| InChIKey | DRPALQRIQDSIIU-RXAQPPLBSA-N |
| XLogP | 5.47 |
| TPSA | 82.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.56 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|