C23H29NO4 — CID 155448166
[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] N-(oxomethylidene)carbamate (PubChem CID 155448166) has the molecular formula C23H29NO4 and a molecular weight of 383.49 g/mol. Its IUPAC name is [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] N-(oxomethylidene)carbamate.
| Compound Name | [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] N-(oxomethylidene)carbamate |
|---|---|
| PubChem CID | 155448166 |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] N-(oxomethylidene)carbamate |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(CCCCC)cc1OC(=O)N=C=O |
| InChI | InChI=1S/C23H29NO4/c1-5-6-7-8-17-12-20(26)22(21(13-17)28-23(27)24-14-25)19-11-16(4)9-10-18(19)15(2)3/h11-13,18-19,26H,2,5-10H2,1,3-4H3/t18-,19+/m0/s1 |
| InChIKey | PCGSRHIZNBCHGA-RBUKOAKNSA-N |
| XLogP | 5.98 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|