C27H34O2 — CID 134535502
2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentyl-3-phenoxyphenol (PubChem CID 134535502) has the molecular formula C27H34O2 and a molecular weight of 390.57 g/mol. Its IUPAC name is 2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentyl-3-phenoxyphenol.
| Compound Name | 2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentyl-3-phenoxyphenol |
|---|---|
| PubChem CID | 134535502 |
| Molecular Formula | C27H34O2 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.26 |
| IUPAC Name | 2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentyl-3-phenoxyphenol |
| SMILES | C=C(C)C1CCC(C)=CC1c1c(O)cc(CCCCC)cc1Oc1ccccc1 |
| InChI | InChI=1S/C27H34O2/c1-5-6-8-11-21-17-25(28)27(24-16-20(4)14-15-23(24)19(2)3)26(18-21)29-22-12-9-7-10-13-22/h7,9-10,12-13,16-18,23-24,28H,2,5-6,8,11,14-15H2,1,3-4H3 |
| InChIKey | OUJWJXGNNMPUCE-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|