C26H35NO5S — CID 175947450
[3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] hydrogen sulfate;pyridine (PubChem CID 175947450) has the molecular formula C26H35NO5S and a molecular weight of 473.64 g/mol. Its IUPAC name is [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] hydrogen sulfate;pyridine.
| Compound Name | [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] hydrogen sulfate;pyridine |
|---|---|
| PubChem CID | 175947450 |
| Molecular Formula | C26H35NO5S |
| Molecular Weight | 473.64 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | [3-hydroxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylphenyl] hydrogen sulfate;pyridine |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(CCCCC)cc1OS(=O)(=O)O.c1ccncc1 |
| InChI | InChI=1S/C21H30O5S.C5H5N/c1-5-6-7-8-16-12-19(22)21(20(13-16)26-27(23,24)25)18-11-15(4)9-10-17(18)14(2)3;1-2-4-6-5-3-1/h11-13,17-18,22H,2,5-10H2,1,3-4H3,(H,23,24,25);1-5H/t17-,18+;/m0./s1 |
| InChIKey | DEPWZXYYNAOPIF-CJRXIRLBSA-N |
| XLogP | 6.40 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.64 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|