C25H30O2 — CID 164818433
3-methoxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-(2-phenylethyl)phenol (PubChem CID 164818433) has the molecular formula C25H30O2 and a molecular weight of 362.51 g/mol. Its IUPAC name is 3-methoxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-(2-phenylethyl)phenol.
| Compound Name | 3-methoxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-(2-phenylethyl)phenol |
|---|---|
| PubChem CID | 164818433 |
| Molecular Formula | C25H30O2 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | 3-methoxy-2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-(2-phenylethyl)phenol |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(CCc2ccccc2)cc1OC |
| InChI | InChI=1S/C25H30O2/c1-17(2)21-13-10-18(3)14-22(21)25-23(26)15-20(16-24(25)27-4)12-11-19-8-6-5-7-9-19/h5-9,14-16,21-22,26H,1,10-13H2,2-4H3/t21-,22+/m0/s1 |
| InChIKey | ZUHUJJJOFJBQMI-FCHUYYIVSA-N |
| XLogP | 6.20 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|