C24H28O2 — CID 166012040
5-(2-phenylethyl)-2-[6-prop-1-en-2-yl-3-(trideuteriomethyl)cyclohex-2-en-1-yl]benzene-1,3-diol (PubChem CID 166012040) has the molecular formula C24H28O2 and a molecular weight of 351.50 g/mol. Its IUPAC name is 5-(2-phenylethyl)-2-[6-prop-1-en-2-yl-3-(trideuteriomethyl)cyclohex-2-en-1-yl]benzene-1,3-diol.
| Compound Name | 5-(2-phenylethyl)-2-[6-prop-1-en-2-yl-3-(trideuteriomethyl)cyclohex-2-en-1-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 166012040 |
| Molecular Formula | C24H28O2 |
| Molecular Weight | 351.50 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | 5-(2-phenylethyl)-2-[6-prop-1-en-2-yl-3-(trideuteriomethyl)cyclohex-2-en-1-yl]benzene-1,3-diol |
| SMILES | [2H]C([2H])([2H])C1=CC(c2c(O)cc(CCc3ccccc3)cc2O)C(C(=C)C)CC1 |
| InChI | InChI=1S/C24H28O2/c1-16(2)20-12-9-17(3)13-21(20)24-22(25)14-19(15-23(24)26)11-10-18-7-5-4-6-8-18/h4-8,13-15,20-21,25-26H,1,9-12H2,2-3H3/i3D3 |
| InChIKey | BMVDHVMTQZIHDG-HPRDVNIFSA-N |
| XLogP | 5.90 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.50 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|