C23H34O2 — CID 156775256
5-heptyl-2-[(1S,6S)-6-prop-1-en-2-yl-3-(trideuteriomethyl)cyclohex-2-en-1-yl]benzene-1,3-diol (PubChem CID 156775256) has the molecular formula C23H34O2 and a molecular weight of 345.54 g/mol. Its IUPAC name is 5-heptyl-2-[(1S,6S)-6-prop-1-en-2-yl-3-(trideuteriomethyl)cyclohex-2-en-1-yl]benzene-1,3-diol.
| Compound Name | 5-heptyl-2-[(1S,6S)-6-prop-1-en-2-yl-3-(trideuteriomethyl)cyclohex-2-en-1-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 156775256 |
| Molecular Formula | C23H34O2 |
| Molecular Weight | 345.54 g/mol |
| Exact Mass | 345.27 |
| IUPAC Name | 5-heptyl-2-[(1S,6S)-6-prop-1-en-2-yl-3-(trideuteriomethyl)cyclohex-2-en-1-yl]benzene-1,3-diol |
| SMILES | [2H]C([2H])([2H])C1=C[C@H](c2c(O)cc(CCCCCCC)cc2O)[C@@H](C(=C)C)CC1 |
| InChI | InChI=1S/C23H34O2/c1-5-6-7-8-9-10-18-14-21(24)23(22(25)15-18)20-13-17(4)11-12-19(20)16(2)3/h13-15,19-20,24-25H,2,5-12H2,1,3-4H3/t19-,20+/m1/s1/i4D3 |
| InChIKey | GGHRHCGOMWNLCE-UDEOAXSKSA-N |
| XLogP | 6.63 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.54 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|