C21H29FO2 — CID 157062321
2-[(1R,6R)-3-(fluoromethyl)-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylbenzene-1,3-diol (PubChem CID 157062321) has the molecular formula C21H29FO2 and a molecular weight of 332.46 g/mol. Its IUPAC name is 2-[(1R,6R)-3-(fluoromethyl)-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylbenzene-1,3-diol.
| Compound Name | 2-[(1R,6R)-3-(fluoromethyl)-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylbenzene-1,3-diol |
|---|---|
| PubChem CID | 157062321 |
| Molecular Formula | C21H29FO2 |
| Molecular Weight | 332.46 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | 2-[(1R,6R)-3-(fluoromethyl)-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylbenzene-1,3-diol |
| SMILES | C=C(C)[C@@H]1CCC(CF)=C[C@H]1c1c(O)cc(CCCCC)cc1O |
| InChI | InChI=1S/C21H29FO2/c1-4-5-6-7-15-11-19(23)21(20(24)12-15)18-10-16(13-22)8-9-17(18)14(2)3/h10-12,17-18,23-24H,2,4-9,13H2,1,3H3/t17-,18+/m0/s1 |
| InChIKey | XSDCXVZTIFSIOZ-ZWKOTPCHSA-N |
| XLogP | 5.80 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.46 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|