C21H28O3 — CID 146666345
2-[(1R)-2-(2,6-dihydroxy-4-pentylphenyl)-4-methylcyclohex-3-en-1-yl]prop-2-enal (PubChem CID 146666345) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is 2-[(1R)-2-(2,6-dihydroxy-4-pentylphenyl)-4-methylcyclohex-3-en-1-yl]prop-2-enal.
| Compound Name | 2-[(1R)-2-(2,6-dihydroxy-4-pentylphenyl)-4-methylcyclohex-3-en-1-yl]prop-2-enal |
|---|---|
| PubChem CID | 146666345 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 2-[(1R)-2-(2,6-dihydroxy-4-pentylphenyl)-4-methylcyclohex-3-en-1-yl]prop-2-enal |
| SMILES | C=C(C=O)[C@@H]1CCC(C)=CC1c1c(O)cc(CCCCC)cc1O |
| InChI | InChI=1S/C21H28O3/c1-4-5-6-7-16-11-19(23)21(20(24)12-16)18-10-14(2)8-9-17(18)15(3)13-22/h10-13,17-18,23-24H,3-9H2,1-2H3/t17-,18?/m0/s1 |
| InChIKey | FRMGXHQCAWNSFJ-ZENAZSQFSA-N |
| XLogP | 5.03 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|