C21H32O3 — CID 166058573
2-[(1S,6S)-6-(1,1,1,3,3,3-hexadeuterio-2-hydroxypropan-2-yl)-3-(trideuteriomethyl)cyclohex-2-en-1-yl]-5-pentylbenzene-1,3-diol (PubChem CID 166058573) has the molecular formula C21H32O3 and a molecular weight of 341.54 g/mol. Its IUPAC name is 2-[(1S,6S)-6-(1,1,1,3,3,3-hexadeuterio-2-hydroxypropan-2-yl)-3-(trideuteriomethyl)cyclohex-2-en-1-yl]-5-pentylbenzene-1,3-diol.
| Compound Name | 2-[(1S,6S)-6-(1,1,1,3,3,3-hexadeuterio-2-hydroxypropan-2-yl)-3-(trideuteriomethyl)cyclohex-2-en-1-yl]-5-pentylbenzene-1,3-diol |
|---|---|
| PubChem CID | 166058573 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.29 |
| IUPAC Name | 2-[(1S,6S)-6-(1,1,1,3,3,3-hexadeuterio-2-hydroxypropan-2-yl)-3-(trideuteriomethyl)cyclohex-2-en-1-yl]-5-pentylbenzene-1,3-diol |
| SMILES | [2H]C([2H])([2H])C1=C[C@H](c2c(O)cc(CCCCC)cc2O)[C@@H](C(O)(C([2H])([2H])[2H])C([2H])([2H])[2H])CC1 |
| InChI | InChI=1S/C21H32O3/c1-5-6-7-8-15-12-18(22)20(19(23)13-15)16-11-14(2)9-10-17(16)21(3,4)24/h11-13,16-17,22-24H,5-10H2,1-4H3/t16-,17-/m0/s1/i2D3,3D3,4D3 |
| InChIKey | FTDORWGKHUOHKJ-AOTXOZIASA-N |
| XLogP | 5.04 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|