C24H39NO2 — CID 145469949
3-(2-aminoethoxy)-2-[(6R)-6-tert-butyl-3-methylcyclohex-2-en-1-yl]-5-pentylphenol (PubChem CID 145469949) has the molecular formula C24H39NO2 and a molecular weight of 373.58 g/mol. Its IUPAC name is 3-(2-aminoethoxy)-2-[(6R)-6-tert-butyl-3-methylcyclohex-2-en-1-yl]-5-pentylphenol.
| Compound Name | 3-(2-aminoethoxy)-2-[(6R)-6-tert-butyl-3-methylcyclohex-2-en-1-yl]-5-pentylphenol |
|---|---|
| PubChem CID | 145469949 |
| Molecular Formula | C24H39NO2 |
| Molecular Weight | 373.58 g/mol |
| Exact Mass | 373.30 |
| IUPAC Name | 3-(2-aminoethoxy)-2-[(6R)-6-tert-butyl-3-methylcyclohex-2-en-1-yl]-5-pentylphenol |
| SMILES | CCCCCc1cc(O)c(C2C=C(C)CC[C@H]2C(C)(C)C)c(OCCN)c1 |
| InChI | InChI=1S/C24H39NO2/c1-6-7-8-9-18-15-21(26)23(22(16-18)27-13-12-25)19-14-17(2)10-11-20(19)24(3,4)5/h14-16,19-20,26H,6-13,25H2,1-5H3/t19?,20-/m1/s1 |
| InChIKey | RUEIQGWFGNEKOS-GFOWMXPYSA-N |
| XLogP | 5.95 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.58 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|