C22H32O4 — CID 145469946
2-[2-(6-ethyl-3-methylcyclohex-2-en-1-yl)-3-hydroxy-5-pentylphenoxy]acetic acid (PubChem CID 145469946) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is 2-[2-(6-ethyl-3-methylcyclohex-2-en-1-yl)-3-hydroxy-5-pentylphenoxy]acetic acid.
| Compound Name | 2-[2-(6-ethyl-3-methylcyclohex-2-en-1-yl)-3-hydroxy-5-pentylphenoxy]acetic acid |
|---|---|
| PubChem CID | 145469946 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | 2-[2-(6-ethyl-3-methylcyclohex-2-en-1-yl)-3-hydroxy-5-pentylphenoxy]acetic acid |
| SMILES | CCCCCc1cc(O)c(C2C=C(C)CCC2CC)c(OCC(=O)O)c1 |
| InChI | InChI=1S/C22H32O4/c1-4-6-7-8-16-12-19(23)22(20(13-16)26-14-21(24)25)18-11-15(3)9-10-17(18)5-2/h11-13,17-18,23H,4-10,14H2,1-3H3,(H,24,25) |
| InChIKey | NHNHQYOFOURZKF-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|