C22H28O6 — CID 168900338
(3R,4R)-3-[2-(carboxymethoxy)-6-hydroxy-4-pentylphenyl]-4-prop-1-en-2-ylcyclopentene-1-carboxylic acid (PubChem CID 168900338) has the molecular formula C22H28O6 and a molecular weight of 388.46 g/mol. Its IUPAC name is (3R,4R)-3-[2-(carboxymethoxy)-6-hydroxy-4-pentylphenyl]-4-prop-1-en-2-ylcyclopentene-1-carboxylic acid.
| Compound Name | (3R,4R)-3-[2-(carboxymethoxy)-6-hydroxy-4-pentylphenyl]-4-prop-1-en-2-ylcyclopentene-1-carboxylic acid |
|---|---|
| PubChem CID | 168900338 |
| Molecular Formula | C22H28O6 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | (3R,4R)-3-[2-(carboxymethoxy)-6-hydroxy-4-pentylphenyl]-4-prop-1-en-2-ylcyclopentene-1-carboxylic acid |
| SMILES | C=C(C)[C@@H]1CC(C(=O)O)=C[C@H]1c1c(O)cc(CCCCC)cc1OCC(=O)O |
| InChI | InChI=1S/C22H28O6/c1-4-5-6-7-14-8-18(23)21(19(9-14)28-12-20(24)25)17-11-15(22(26)27)10-16(17)13(2)3/h8-9,11,16-17,23H,2,4-7,10,12H2,1,3H3,(H,24,25)(H,26,27)/t16-,17+/m0/s1 |
| InChIKey | XVARZXSYBMSHQR-DLBZAZTESA-N |
| XLogP | 4.28 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|