C19H27ClO2 — CID 156727476
3-(chloromethoxy)-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenol (PubChem CID 156727476) has the molecular formula C19H27ClO2 and a molecular weight of 322.88 g/mol. Its IUPAC name is 3-(chloromethoxy)-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenol.
| Compound Name | 3-(chloromethoxy)-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenol |
|---|---|
| PubChem CID | 156727476 |
| Molecular Formula | C19H27ClO2 |
| Molecular Weight | 322.88 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 3-(chloromethoxy)-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenol |
| SMILES | CCCCCc1cc(O)c(C2C=C(C)CCC2)c(OCCl)c1 |
| InChI | InChI=1S/C19H27ClO2/c1-3-4-5-8-15-11-17(21)19(18(12-15)22-13-20)16-9-6-7-14(2)10-16/h10-12,16,21H,3-9,13H2,1-2H3 |
| InChIKey | BVKHMUQOCXHVBL-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.88 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|