C26H42O2 — CID 155724419
5-decyl-2-(3-methylcyclohex-2-en-1-yl)benzene-1,3-diol;prop-1-ene (PubChem CID 155724419) has the molecular formula C26H42O2 and a molecular weight of 386.62 g/mol. Its IUPAC name is 5-decyl-2-(3-methylcyclohex-2-en-1-yl)benzene-1,3-diol;prop-1-ene.
| Compound Name | 5-decyl-2-(3-methylcyclohex-2-en-1-yl)benzene-1,3-diol;prop-1-ene |
|---|---|
| PubChem CID | 155724419 |
| Molecular Formula | C26H42O2 |
| Molecular Weight | 386.62 g/mol |
| Exact Mass | 386.32 |
| IUPAC Name | 5-decyl-2-(3-methylcyclohex-2-en-1-yl)benzene-1,3-diol;prop-1-ene |
| SMILES | C=CC.CCCCCCCCCCc1cc(O)c(C2C=C(C)CCC2)c(O)c1 |
| InChI | InChI=1S/C23H36O2.C3H6/c1-3-4-5-6-7-8-9-10-13-19-16-21(24)23(22(25)17-19)20-14-11-12-18(2)15-20;1-3-2/h15-17,20,24-25H,3-14H2,1-2H3;3H,1H2,2H3 |
| InChIKey | HHZKKXGSLGSYNZ-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.62 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|