C21H31BO3 — CID 164591569
CID 164591569 (PubChem CID 164591569) has the molecular formula C21H31BO3 and a molecular weight of 342.29 g/mol.
| Compound Name | CID 164591569 |
|---|---|
| PubChem CID | 164591569 |
| Molecular Formula | C21H31BO3 |
| Molecular Weight | 342.29 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | — |
| SMILES | C=CC.[B]c1c(O)c([C@@H]2C=C(C)CCC2)c(O)c(O)c1CCCCC |
| InChI | InChI=1S/C18H25BO3.C3H6/c1-3-4-5-9-13-15(19)17(21)14(18(22)16(13)20)12-8-6-7-11(2)10-12;1-3-2/h10,12,20-22H,3-9H2,1-2H3;3H,1H2,2H3/t12-;/m0./s1 |
| InChIKey | BXGWBYVBAOZBJK-YDALLXLXSA-N |
| XLogP | 4.74 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.29 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|