C20H28O4 — CID 164591554
5-ethenoxy-6-(3-methylcyclohex-2-en-1-yl)-3-pentylbenzene-1,2,4-triol (PubChem CID 164591554) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is 5-ethenoxy-6-(3-methylcyclohex-2-en-1-yl)-3-pentylbenzene-1,2,4-triol.
| Compound Name | 5-ethenoxy-6-(3-methylcyclohex-2-en-1-yl)-3-pentylbenzene-1,2,4-triol |
|---|---|
| PubChem CID | 164591554 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 5-ethenoxy-6-(3-methylcyclohex-2-en-1-yl)-3-pentylbenzene-1,2,4-triol |
| SMILES | C=COc1c(O)c(CCCCC)c(O)c(O)c1C1C=C(C)CCC1 |
| InChI | InChI=1S/C20H28O4/c1-4-6-7-11-15-17(21)19(23)16(20(18(15)22)24-5-2)14-10-8-9-13(3)12-14/h5,12,14,21-23H,2,4,6-11H2,1,3H3 |
| InChIKey | KLSVYZLTIJUNBW-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|