C23H33NO3 — CID 170609114
[3-ethenoxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenyl] N-ethylcarbamate (PubChem CID 170609114) has the molecular formula C23H33NO3 and a molecular weight of 371.52 g/mol. Its IUPAC name is [3-ethenoxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenyl] N-ethylcarbamate.
| Compound Name | [3-ethenoxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenyl] N-ethylcarbamate |
|---|---|
| PubChem CID | 170609114 |
| Molecular Formula | C23H33NO3 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | [3-ethenoxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenyl] N-ethylcarbamate |
| SMILES | C=COc1cc(CCCCC)cc(OC(=O)NCC)c1C1C=C(C)CCC1 |
| InChI | InChI=1S/C23H33NO3/c1-5-8-9-12-18-15-20(26-7-3)22(19-13-10-11-17(4)14-19)21(16-18)27-23(25)24-6-2/h7,14-16,19H,3,5-6,8-13H2,1-2,4H3,(H,24,25) |
| InChIKey | VFIQAASQJRIBQM-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|