C21H32O2 — CID 155575168
2-[(1S)-3-methylcyclohex-2-en-1-yl]-5-pentyl-3-propan-2-yloxyphenol (PubChem CID 155575168) has the molecular formula C21H32O2 and a molecular weight of 316.49 g/mol. Its IUPAC name is 2-[(1S)-3-methylcyclohex-2-en-1-yl]-5-pentyl-3-propan-2-yloxyphenol.
| Compound Name | 2-[(1S)-3-methylcyclohex-2-en-1-yl]-5-pentyl-3-propan-2-yloxyphenol |
|---|---|
| PubChem CID | 155575168 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | 2-[(1S)-3-methylcyclohex-2-en-1-yl]-5-pentyl-3-propan-2-yloxyphenol |
| SMILES | CCCCCc1cc(O)c([C@@H]2C=C(C)CCC2)c(OC(C)C)c1 |
| InChI | InChI=1S/C21H32O2/c1-5-6-7-10-17-13-19(22)21(20(14-17)23-15(2)3)18-11-8-9-16(4)12-18/h12-15,18,22H,5-11H2,1-4H3/t18-/m0/s1 |
| InChIKey | XWSWBTFJLVUMLA-SFHVURJKSA-N |
| XLogP | 6.13 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|