C22H31ClO3 — CID 156727455
[3-hydroxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenyl] carbonochloridate;prop-1-ene (PubChem CID 156727455) has the molecular formula C22H31ClO3 and a molecular weight of 378.94 g/mol. Its IUPAC name is [3-hydroxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenyl] carbonochloridate;prop-1-ene.
| Compound Name | [3-hydroxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenyl] carbonochloridate;prop-1-ene |
|---|---|
| PubChem CID | 156727455 |
| Molecular Formula | C22H31ClO3 |
| Molecular Weight | 378.94 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | [3-hydroxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenyl] carbonochloridate;prop-1-ene |
| SMILES | C=CC.CCCCCc1cc(O)c(C2C=C(C)CCC2)c(OC(=O)Cl)c1 |
| InChI | InChI=1S/C19H25ClO3.C3H6/c1-3-4-5-8-14-11-16(21)18(17(12-14)23-19(20)22)15-9-6-7-13(2)10-15;1-3-2/h10-12,15,21H,3-9H2,1-2H3;3H,1H2,2H3 |
| InChIKey | ICSKVELXQSKUCA-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.94 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|