C26H39NO3 — CID 155749030
3-ethyl-4-[3-hydroxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenoxy]azetidin-2-one;prop-1-ene (PubChem CID 155749030) has the molecular formula C26H39NO3 and a molecular weight of 413.60 g/mol. Its IUPAC name is 3-ethyl-4-[3-hydroxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenoxy]azetidin-2-one;prop-1-ene.
| Compound Name | 3-ethyl-4-[3-hydroxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenoxy]azetidin-2-one;prop-1-ene |
|---|---|
| PubChem CID | 155749030 |
| Molecular Formula | C26H39NO3 |
| Molecular Weight | 413.60 g/mol |
| Exact Mass | 413.29 |
| IUPAC Name | 3-ethyl-4-[3-hydroxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenoxy]azetidin-2-one;prop-1-ene |
| SMILES | C=CC.CCCCCc1cc(O)c(C2C=C(C)CCC2)c(OC2NC(=O)C2CC)c1 |
| InChI | InChI=1S/C23H33NO3.C3H6/c1-4-6-7-10-16-13-19(25)21(17-11-8-9-15(3)12-17)20(14-16)27-23-18(5-2)22(26)24-23;1-3-2/h12-14,17-18,23,25H,4-11H2,1-3H3,(H,24,26);3H,1H2,2H3 |
| InChIKey | UYFJMGONMPWHFB-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.60 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|