C25H39O6P — CID 155575875
ethyl 4-[[3-hydroxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenoxy]-methoxyphosphoryl]butanoate (PubChem CID 155575875) has the molecular formula C25H39O6P and a molecular weight of 466.56 g/mol. Its IUPAC name is ethyl 4-[[3-hydroxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenoxy]-methoxyphosphoryl]butanoate.
| Compound Name | ethyl 4-[[3-hydroxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenoxy]-methoxyphosphoryl]butanoate |
|---|---|
| PubChem CID | 155575875 |
| Molecular Formula | C25H39O6P |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | ethyl 4-[[3-hydroxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenoxy]-methoxyphosphoryl]butanoate |
| SMILES | CCCCCc1cc(O)c(C2C=C(C)CCC2)c(OP(=O)(CCCC(=O)OCC)OC)c1 |
| InChI | InChI=1S/C25H39O6P/c1-5-7-8-12-20-17-22(26)25(21-13-9-11-19(3)16-21)23(18-20)31-32(28,29-4)15-10-14-24(27)30-6-2/h16-18,21,26H,5-15H2,1-4H3 |
| InChIKey | HUKFLSWADQKHMA-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|