C22H31BrO3S — CID 155447459
[3-hydroxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenyl] 3-bromopropylsulfanylformate (PubChem CID 155447459) has the molecular formula C22H31BrO3S and a molecular weight of 455.46 g/mol. Its IUPAC name is [3-hydroxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenyl] 3-bromopropylsulfanylformate.
| Compound Name | [3-hydroxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenyl] 3-bromopropylsulfanylformate |
|---|---|
| PubChem CID | 155447459 |
| Molecular Formula | C22H31BrO3S |
| Molecular Weight | 455.46 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | [3-hydroxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenyl] 3-bromopropylsulfanylformate |
| SMILES | CCCCCc1cc(O)c(C2C=C(C)CCC2)c(OC(=O)SCCCBr)c1 |
| InChI | InChI=1S/C22H31BrO3S/c1-3-4-5-9-17-14-19(24)21(18-10-6-8-16(2)13-18)20(15-17)26-22(25)27-12-7-11-23/h13-15,18,24H,3-12H2,1-2H3 |
| InChIKey | OBPGTFJDXNMRRQ-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.46 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|