C26H35O4P — CID 155575815
3-[benzyl(methoxy)phosphoryl]oxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenol (PubChem CID 155575815) has the molecular formula C26H35O4P and a molecular weight of 442.54 g/mol. Its IUPAC name is 3-[benzyl(methoxy)phosphoryl]oxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenol.
| Compound Name | 3-[benzyl(methoxy)phosphoryl]oxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenol |
|---|---|
| PubChem CID | 155575815 |
| Molecular Formula | C26H35O4P |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 3-[benzyl(methoxy)phosphoryl]oxy-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenol |
| SMILES | CCCCCc1cc(O)c(C2C=C(C)CCC2)c(OP(=O)(Cc2ccccc2)OC)c1 |
| InChI | InChI=1S/C26H35O4P/c1-4-5-7-14-22-17-24(27)26(23-15-10-11-20(2)16-23)25(18-22)30-31(28,29-3)19-21-12-8-6-9-13-21/h6,8-9,12-13,16-18,23,27H,4-5,7,10-11,14-15,19H2,1-3H3 |
| InChIKey | ODNARBKGTTXAOY-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|