C43H46O10P2 — CID 155575836
[3-(diphenoxyphosphoryloxymethoxy)-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenoxy] diphenyl phosphate (PubChem CID 155575836) has the molecular formula C43H46O10P2 and a molecular weight of 784.78 g/mol. Its IUPAC name is [3-(diphenoxyphosphoryloxymethoxy)-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenoxy] diphenyl phosphate.
| Compound Name | [3-(diphenoxyphosphoryloxymethoxy)-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenoxy] diphenyl phosphate |
|---|---|
| PubChem CID | 155575836 |
| Molecular Formula | C43H46O10P2 |
| Molecular Weight | 784.78 g/mol |
| Exact Mass | 784.26 |
| IUPAC Name | [3-(diphenoxyphosphoryloxymethoxy)-2-(3-methylcyclohex-2-en-1-yl)-5-pentylphenoxy] diphenyl phosphate |
| SMILES | CCCCCc1cc(OCOP(=O)(Oc2ccccc2)Oc2ccccc2)c(C2C=C(C)CCC2)c(OOP(=O)(Oc2ccccc2)Oc2ccccc2)c1 |
| InChI | InChI=1S/C43H46O10P2/c1-3-4-9-20-35-31-41(46-33-47-54(44,49-37-22-10-5-11-23-37)50-38-24-12-6-13-25-38)43(36-21-18-19-34(2)30-36)42(32-35)48-53-55(45,51-39-26-14-7-15-27-39)52-40-28-16-8-17-29-40/h5-8,10-17,22-32,36H,3-4,9,18-21,33H2,1-2H3 |
| InChIKey | DPQTXBFAOBNHHS-UHFFFAOYSA-N |
| XLogP | 12.83 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.78 |
| LogP ≤ 5 | 12.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|