C37H48O9P2 — CID 167671759
methyl [3-[[methyl(phenoxy)phosphoryl]oxymethoxy]-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenoxy]methyl phenyl phosphate (PubChem CID 167671759) has the molecular formula C37H48O9P2 and a molecular weight of 698.73 g/mol. Its IUPAC name is methyl [3-[[methyl(phenoxy)phosphoryl]oxymethoxy]-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenoxy]methyl phenyl phosphate.
| Compound Name | methyl [3-[[methyl(phenoxy)phosphoryl]oxymethoxy]-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenoxy]methyl phenyl phosphate |
|---|---|
| PubChem CID | 167671759 |
| Molecular Formula | C37H48O9P2 |
| Molecular Weight | 698.73 g/mol |
| Exact Mass | 698.28 |
| IUPAC Name | methyl [3-[[methyl(phenoxy)phosphoryl]oxymethoxy]-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenoxy]methyl phenyl phosphate |
| SMILES | C=C(C)C1CCC(C)=CC1c1c(OCOP(C)(=O)Oc2ccccc2)cc(CCCCC)cc1OCOP(=O)(OC)Oc1ccccc1 |
| InChI | InChI=1S/C37H48O9P2/c1-7-8-11-16-30-24-35(41-26-43-47(6,38)45-31-17-12-9-13-18-31)37(34-23-29(4)21-22-33(34)28(2)3)36(25-30)42-27-44-48(39,40-5)46-32-19-14-10-15-20-32/h9-10,12-15,17-20,23-25,33-34H,2,7-8,11,16,21-22,26-27H2,1,3-6H3 |
| InChIKey | UFIQXONPAKLHAV-UHFFFAOYSA-N |
| XLogP | 10.88 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.73 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|