C41H48O9P2 — CID 167594205
[3-[methyl(phenoxy)phosphoryl]peroxy-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenoxy]methyl diphenyl phosphate (PubChem CID 167594205) has the molecular formula C41H48O9P2 and a molecular weight of 746.77 g/mol. Its IUPAC name is [3-[methyl(phenoxy)phosphoryl]peroxy-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenoxy]methyl diphenyl phosphate.
| Compound Name | [3-[methyl(phenoxy)phosphoryl]peroxy-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenoxy]methyl diphenyl phosphate |
|---|---|
| PubChem CID | 167594205 |
| Molecular Formula | C41H48O9P2 |
| Molecular Weight | 746.77 g/mol |
| Exact Mass | 746.28 |
| IUPAC Name | [3-[methyl(phenoxy)phosphoryl]peroxy-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenoxy]methyl diphenyl phosphate |
| SMILES | C=C(C)C1CCC(C)=CC1c1c(OCOP(=O)(Oc2ccccc2)Oc2ccccc2)cc(CCCCC)cc1OOP(C)(=O)Oc1ccccc1 |
| InChI | InChI=1S/C41H48O9P2/c1-6-7-11-18-33-28-39(44-30-45-52(43,48-35-21-14-9-15-22-35)49-36-23-16-10-17-24-36)41(38-27-32(4)25-26-37(38)31(2)3)40(29-33)46-50-51(5,42)47-34-19-12-8-13-20-34/h8-10,12-17,19-24,27-29,37-38H,2,6-7,11,18,25-26,30H2,1,3-5H3 |
| InChIKey | IVJFJCQJGJORAJ-UHFFFAOYSA-N |
| XLogP | 12.27 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.77 |
| LogP ≤ 5 | 12.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|