C35H56O10P2 — CID 155575629
ethyl 4-[[3-[(4-ethoxy-4-oxobutyl)-methoxyphosphoryl]oxy-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenoxy]-methoxyphosphoryl]butanoate (PubChem CID 155575629) has the molecular formula C35H56O10P2 and a molecular weight of 698.77 g/mol. Its IUPAC name is ethyl 4-[[3-[(4-ethoxy-4-oxobutyl)-methoxyphosphoryl]oxy-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenoxy]-methoxyphosphoryl]butanoate.
| Compound Name | ethyl 4-[[3-[(4-ethoxy-4-oxobutyl)-methoxyphosphoryl]oxy-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenoxy]-methoxyphosphoryl]butanoate |
|---|---|
| PubChem CID | 155575629 |
| Molecular Formula | C35H56O10P2 |
| Molecular Weight | 698.77 g/mol |
| Exact Mass | 698.33 |
| IUPAC Name | ethyl 4-[[3-[(4-ethoxy-4-oxobutyl)-methoxyphosphoryl]oxy-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenoxy]-methoxyphosphoryl]butanoate |
| SMILES | C=C(C)C1CCC(C)=CC1c1c(OP(=O)(CCCC(=O)OCC)OC)cc(CCCCC)cc1OP(=O)(CCCC(=O)OCC)OC |
| InChI | InChI=1S/C35H56O10P2/c1-9-12-13-16-28-24-31(44-46(38,40-7)21-14-17-33(36)42-10-2)35(30-23-27(6)19-20-29(30)26(4)5)32(25-28)45-47(39,41-8)22-15-18-34(37)43-11-3/h23-25,29-30H,4,9-22H2,1-3,5-8H3 |
| InChIKey | CHHQSVBAWVDZPY-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.77 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|