C31H48N2O4 — CID 25177095
[3-[3-(dimethylamino)propanoyloxy]-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenyl] 3-(dimethylamino)propanoate (PubChem CID 25177095) has the molecular formula C31H48N2O4 and a molecular weight of 512.74 g/mol. Its IUPAC name is [3-[3-(dimethylamino)propanoyloxy]-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenyl] 3-(dimethylamino)propanoate.
| Compound Name | [3-[3-(dimethylamino)propanoyloxy]-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenyl] 3-(dimethylamino)propanoate |
|---|---|
| PubChem CID | 25177095 |
| Molecular Formula | C31H48N2O4 |
| Molecular Weight | 512.74 g/mol |
| Exact Mass | 512.36 |
| IUPAC Name | [3-[3-(dimethylamino)propanoyloxy]-2-(3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl)-5-pentylphenyl] 3-(dimethylamino)propanoate |
| SMILES | C=C(C)C1CCC(C)=CC1c1c(OC(=O)CCN(C)C)cc(CCCCC)cc1OC(=O)CCN(C)C |
| InChI | InChI=1S/C31H48N2O4/c1-9-10-11-12-24-20-27(36-29(34)15-17-32(5)6)31(26-19-23(4)13-14-25(26)22(2)3)28(21-24)37-30(35)16-18-33(7)8/h19-21,25-26H,2,9-18H2,1,3-8H3 |
| InChIKey | MHZTZBIXJSPQOB-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.74 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|